C21H17N3O2 — CID 18962360
N-[3-(acridin-9-ylamino)-5-hydroxyphenyl]acetamide (PubChem CID 18962360) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[3-(acridin-9-ylamino)-5-hydroxyphenyl]acetamide.
| Compound Name | N-[3-(acridin-9-ylamino)-5-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 18962360 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[3-(acridin-9-ylamino)-5-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(O)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C21H17N3O2/c1-13(25)22-14-10-15(12-16(26)11-14)23-21-17-6-2-4-8-19(17)24-20-9-5-3-7-18(20)21/h2-12,26H,1H3,(H,22,25)(H,23,24) |
| InChIKey | POBYUAAXAJJAQQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|