C24H23N3O3 — CID 18962425
ethyl 2-[2-(acridin-9-ylamino)-6-amino-4-(hydroxymethyl)phenyl]acetate (PubChem CID 18962425) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is ethyl 2-[2-(acridin-9-ylamino)-6-amino-4-(hydroxymethyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-(acridin-9-ylamino)-6-amino-4-(hydroxymethyl)phenyl]acetate |
|---|---|
| PubChem CID | 18962425 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 2-[2-(acridin-9-ylamino)-6-amino-4-(hydroxymethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(N)cc(CO)cc1Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C24H23N3O3/c1-2-30-23(29)13-18-19(25)11-15(14-28)12-22(18)27-24-16-7-3-5-9-20(16)26-21-10-6-4-8-17(21)24/h3-12,28H,2,13-14,25H2,1H3,(H,26,27) |
| InChIKey | FCSOXXUCXBJQLI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|