C34H35N3O2 — CID 59761594
[3-(acridin-9-ylamino)-5-methylphenyl]methyl 2-[4-[ethyl(propyl)amino]phenyl]acetate (PubChem CID 59761594) has the molecular formula C34H35N3O2 and a molecular weight of 517.67 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-methylphenyl]methyl 2-[4-[ethyl(propyl)amino]phenyl]acetate.
| Compound Name | [3-(acridin-9-ylamino)-5-methylphenyl]methyl 2-[4-[ethyl(propyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 59761594 |
| Molecular Formula | C34H35N3O2 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-methylphenyl]methyl 2-[4-[ethyl(propyl)amino]phenyl]acetate |
| SMILES | CCCN(CC)c1ccc(CC(=O)OCc2cc(C)cc(Nc3c4ccccc4nc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C34H35N3O2/c1-4-18-37(5-2)28-16-14-25(15-17-28)22-33(38)39-23-26-19-24(3)20-27(21-26)35-34-29-10-6-8-12-31(29)36-32-13-9-7-11-30(32)34/h6-17,19-21H,4-5,18,22-23H2,1-3H3,(H,35,36) |
| InChIKey | GJRMKSIBADBBTG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|