C34H33Cl2N5O3 — CID 87747510
[3-(acridin-9-ylamino)-5-(propanoylamino)phenyl]methyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate (PubChem CID 87747510) has the molecular formula C34H33Cl2N5O3 and a molecular weight of 630.58 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-(propanoylamino)phenyl]methyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate.
| Compound Name | [3-(acridin-9-ylamino)-5-(propanoylamino)phenyl]methyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 87747510 |
| Molecular Formula | C34H33Cl2N5O3 |
| Molecular Weight | 630.58 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-(propanoylamino)phenyl]methyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate |
| SMILES | CCC(=O)Nc1cc(COC(=O)Nc2ccc(N(CCCl)CCCl)cc2)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C34H33Cl2N5O3/c1-2-32(42)37-25-19-23(22-44-34(43)39-24-11-13-27(14-12-24)41(17-15-35)18-16-36)20-26(21-25)38-33-28-7-3-5-9-30(28)40-31-10-6-4-8-29(31)33/h3-14,19-21H,2,15-18,22H2,1H3,(H,37,42)(H,38,40)(H,39,43) |
| InChIKey | LIBSMZHCWYRAQI-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.58 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|