C33H32Cl2N6O3 — CID 87746997
9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-(hydroxymethyl)anilino]-N-methylacridine-4-carboxamide (PubChem CID 87746997) has the molecular formula C33H32Cl2N6O3 and a molecular weight of 631.56 g/mol. Its IUPAC name is 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-(hydroxymethyl)anilino]-N-methylacridine-4-carboxamide.
| Compound Name | 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-(hydroxymethyl)anilino]-N-methylacridine-4-carboxamide |
|---|---|
| PubChem CID | 87746997 |
| Molecular Formula | C33H32Cl2N6O3 |
| Molecular Weight | 631.56 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-(hydroxymethyl)anilino]-N-methylacridine-4-carboxamide |
| SMILES | CNC(=O)c1cccc2c(Nc3cc(CO)cc(NC(=O)Nc4ccc(N(CCCl)CCCl)cc4)c3)c3ccccc3nc12 |
| InChI | InChI=1S/C33H32Cl2N6O3/c1-36-32(43)28-7-4-6-27-30(26-5-2-3-8-29(26)40-31(27)28)37-23-17-21(20-42)18-24(19-23)39-33(44)38-22-9-11-25(12-10-22)41(15-13-34)16-14-35/h2-12,17-19,42H,13-16,20H2,1H3,(H,36,43)(H,37,40)(H2,38,39,44) |
| InChIKey | RTAKYWRWKABFES-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.56 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|