C37H41Cl2N7O2 — CID 90842585
9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methylanilino]-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide (PubChem CID 90842585) has the molecular formula C37H41Cl2N7O2 and a molecular weight of 686.69 g/mol. Its IUPAC name is 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methylanilino]-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide.
| Compound Name | 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methylanilino]-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide |
|---|---|
| PubChem CID | 90842585 |
| Molecular Formula | C37H41Cl2N7O2 |
| Molecular Weight | 686.69 g/mol |
| Exact Mass | 685.27 |
| IUPAC Name | 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methylanilino]-N-[2-(dimethylamino)ethyl]-5-methylacridine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)Nc2ccc(N(CCCl)CCCl)cc2)cc(Nc2c3cccc(C)c3nc3c(C(=O)NCCN(C)C)cccc23)c1 |
| InChI | InChI=1S/C37H41Cl2N7O2/c1-24-21-27(23-28(22-24)43-37(48)42-26-11-13-29(14-12-26)46(18-15-38)19-16-39)41-34-30-8-5-7-25(2)33(30)44-35-31(34)9-6-10-32(35)36(47)40-17-20-45(3)4/h5-14,21-23H,15-20H2,1-4H3,(H,40,47)(H,41,44)(H2,42,43,48) |
| InChIKey | VYLLBSMZAKBVRT-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.69 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|