C18H19FN4O — CID 1818
9-amino-N-[2-(dimethylamino)ethyl]-5-fluoroacridine-4-carboxamide (PubChem CID 1818) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is 9-amino-N-[2-(dimethylamino)ethyl]-5-fluoroacridine-4-carboxamide.
| Compound Name | 9-amino-N-[2-(dimethylamino)ethyl]-5-fluoroacridine-4-carboxamide |
|---|---|
| PubChem CID | 1818 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 9-amino-N-[2-(dimethylamino)ethyl]-5-fluoroacridine-4-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cccc2c(N)c3cccc(F)c3nc12 |
| InChI | InChI=1S/C18H19FN4O/c1-23(2)10-9-21-18(24)13-7-3-5-11-15(20)12-6-4-8-14(19)17(12)22-16(11)13/h3-8H,9-10H2,1-2H3,(H2,20,22)(H,21,24) |
| InChIKey | QEHXKZSBSOBCGM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|