C24H23Cl2N3O — CID 45262948
6-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]phenanthridine-4-carboxamide;hydrochloride (PubChem CID 45262948) has the molecular formula C24H23Cl2N3O and a molecular weight of 440.37 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]phenanthridine-4-carboxamide;hydrochloride.
| Compound Name | 6-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]phenanthridine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45262948 |
| Molecular Formula | C24H23Cl2N3O |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 6-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]phenanthridine-4-carboxamide;hydrochloride |
| SMILES | CN(C)CCNC(=O)c1cccc2c1nc(-c1ccccc1Cl)c1ccccc12.Cl |
| InChI | InChI=1S/C24H22ClN3O.ClH/c1-28(2)15-14-26-24(29)20-12-7-11-18-16-8-3-4-9-17(16)22(27-23(18)20)19-10-5-6-13-21(19)25;/h3-13H,14-15H2,1-2H3,(H,26,29);1H |
| InChIKey | OBBNASLJLUHVDT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|