C24H23N3O — CID 10690459
N-[2-(dimethylamino)ethyl]-5-phenylacridine-4-carboxamide (PubChem CID 10690459) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-5-phenylacridine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-5-phenylacridine-4-carboxamide |
|---|---|
| PubChem CID | 10690459 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-5-phenylacridine-4-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cccc2cc3cccc(-c4ccccc4)c3nc12 |
| InChI | InChI=1S/C24H23N3O/c1-27(2)15-14-25-24(28)21-13-7-11-19-16-18-10-6-12-20(22(18)26-23(19)21)17-8-4-3-5-9-17/h3-13,16H,14-15H2,1-2H3,(H,25,28) |
| InChIKey | KSGHFZKKWVRRLX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|