C20H23N3O — CID 54432311
N-[2-(dimethylamino)ethyl]-6,7-dimethylacridine-4-carboxamide (PubChem CID 54432311) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-6,7-dimethylacridine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-6,7-dimethylacridine-4-carboxamide |
|---|---|
| PubChem CID | 54432311 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-6,7-dimethylacridine-4-carboxamide |
| SMILES | Cc1cc2cc3cccc(C(=O)NCCN(C)C)c3nc2cc1C |
| InChI | InChI=1S/C20H23N3O/c1-13-10-16-12-15-6-5-7-17(20(24)21-8-9-23(3)4)19(15)22-18(16)11-14(13)2/h5-7,10-12H,8-9H2,1-4H3,(H,21,24) |
| InChIKey | WIIBKOOYIACETR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|