C18H22Cl2N3O2+ — CID 21143217
2-(acridine-4-carbonylamino)ethyl-hydroxy-dimethylazanium;dihydrochloride (PubChem CID 21143217) has the molecular formula C18H22Cl2N3O2+ and a molecular weight of 383.30 g/mol. Its IUPAC name is 2-(acridine-4-carbonylamino)ethyl-hydroxy-dimethylazanium;dihydrochloride.
| Compound Name | 2-(acridine-4-carbonylamino)ethyl-hydroxy-dimethylazanium;dihydrochloride |
|---|---|
| PubChem CID | 21143217 |
| Molecular Formula | C18H22Cl2N3O2+ |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 2-(acridine-4-carbonylamino)ethyl-hydroxy-dimethylazanium;dihydrochloride |
| SMILES | C[N+](C)(O)CCNC(=O)c1cccc2cc3ccccc3nc12.Cl.Cl |
| InChI | InChI=1S/C18H19N3O2.2ClH/c1-21(2,23)11-10-19-18(22)15-8-5-7-14-12-13-6-3-4-9-16(13)20-17(14)15;;/h3-9,12,23H,10-11H2,1-2H3;2*1H/p+1 |
| InChIKey | HOCJYMGCJQVAKL-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|