C37H35Cl2N5O2 — CID 54093592
8-(chloromethyl)-N-[3-[3-[[8-(chloromethyl)acridine-4-carbonyl]amino]propyl-methylamino]propyl]acridine-4-carboxamide (PubChem CID 54093592) has the molecular formula C37H35Cl2N5O2 and a molecular weight of 652.63 g/mol. Its IUPAC name is 8-(chloromethyl)-N-[3-[3-[[8-(chloromethyl)acridine-4-carbonyl]amino]propyl-methylamino]propyl]acridine-4-carboxamide.
| Compound Name | 8-(chloromethyl)-N-[3-[3-[[8-(chloromethyl)acridine-4-carbonyl]amino]propyl-methylamino]propyl]acridine-4-carboxamide |
|---|---|
| PubChem CID | 54093592 |
| Molecular Formula | C37H35Cl2N5O2 |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 651.22 |
| IUPAC Name | 8-(chloromethyl)-N-[3-[3-[[8-(chloromethyl)acridine-4-carbonyl]amino]propyl-methylamino]propyl]acridine-4-carboxamide |
| SMILES | CN(CCCNC(=O)c1cccc2cc3c(CCl)cccc3nc12)CCCNC(=O)c1cccc2cc3c(CCl)cccc3nc12 |
| InChI | InChI=1S/C37H35Cl2N5O2/c1-44(18-6-16-40-36(45)28-12-2-8-24-20-30-26(22-38)10-4-14-32(30)42-34(24)28)19-7-17-41-37(46)29-13-3-9-25-21-31-27(23-39)11-5-15-33(31)43-35(25)29/h2-5,8-15,20-21H,6-7,16-19,22-23H2,1H3,(H,40,45)(H,41,46) |
| InChIKey | MVOGYXVQIFGVCN-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|