C18H20N2O3 — CID 123504584
2-[2-(dimethylamino)ethylcarbamoyl]-6-phenylbenzoic acid (PubChem CID 123504584) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylcarbamoyl]-6-phenylbenzoic acid.
| Compound Name | 2-[2-(dimethylamino)ethylcarbamoyl]-6-phenylbenzoic acid |
|---|---|
| PubChem CID | 123504584 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[2-(dimethylamino)ethylcarbamoyl]-6-phenylbenzoic acid |
| SMILES | CN(C)CCNC(=O)c1cccc(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C18H20N2O3/c1-20(2)12-11-19-17(21)15-10-6-9-14(16(15)18(22)23)13-7-4-3-5-8-13/h3-10H,11-12H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | BUBCRFFOVOIZDL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |