C18H23N3O3 — CID 175433920
2-carbamoyl-3-phenylbenzoic acid;N',N'-dimethylethane-1,2-diamine (PubChem CID 175433920) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-carbamoyl-3-phenylbenzoic acid;N',N'-dimethylethane-1,2-diamine.
| Compound Name | 2-carbamoyl-3-phenylbenzoic acid;N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 175433920 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-carbamoyl-3-phenylbenzoic acid;N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCN.NC(=O)c1c(C(=O)O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C14H11NO3.C4H12N2/c15-13(16)12-10(9-5-2-1-3-6-9)7-4-8-11(12)14(17)18;1-6(2)4-3-5/h1-8H,(H2,15,16)(H,17,18);3-5H2,1-2H3 |
| InChIKey | GJTZJASUCJQOHV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |