C27H29N5O4 — CID 90811123
[5-[[4-[2-(dimethylamino)ethylcarbamoyl]-5-methoxyacridin-9-yl]amino]-2-methylphenyl]carbamic acid (PubChem CID 90811123) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is [5-[[4-[2-(dimethylamino)ethylcarbamoyl]-5-methoxyacridin-9-yl]amino]-2-methylphenyl]carbamic acid.
| Compound Name | [5-[[4-[2-(dimethylamino)ethylcarbamoyl]-5-methoxyacridin-9-yl]amino]-2-methylphenyl]carbamic acid |
|---|---|
| PubChem CID | 90811123 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | [5-[[4-[2-(dimethylamino)ethylcarbamoyl]-5-methoxyacridin-9-yl]amino]-2-methylphenyl]carbamic acid |
| SMILES | COc1cccc2c(Nc3ccc(C)c(NC(=O)O)c3)c3cccc(C(=O)NCCN(C)C)c3nc12 |
| InChI | InChI=1S/C27H29N5O4/c1-16-11-12-17(15-21(16)30-27(34)35)29-23-18-7-5-9-20(26(33)28-13-14-32(2)3)24(18)31-25-19(23)8-6-10-22(25)36-4/h5-12,15,30H,13-14H2,1-4H3,(H,28,33)(H,29,31)(H,34,35) |
| InChIKey | WOGVQCADILPOLX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|