C30H38N6O2 — CID 51033461
9-[4-[3-(2-aminoethylamino)propyl]anilino]-N-[2-(dimethylamino)ethyl]-5-methoxyacridine-4-carboxamide (PubChem CID 51033461) has the molecular formula C30H38N6O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 9-[4-[3-(2-aminoethylamino)propyl]anilino]-N-[2-(dimethylamino)ethyl]-5-methoxyacridine-4-carboxamide.
| Compound Name | 9-[4-[3-(2-aminoethylamino)propyl]anilino]-N-[2-(dimethylamino)ethyl]-5-methoxyacridine-4-carboxamide |
|---|---|
| PubChem CID | 51033461 |
| Molecular Formula | C30H38N6O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 9-[4-[3-(2-aminoethylamino)propyl]anilino]-N-[2-(dimethylamino)ethyl]-5-methoxyacridine-4-carboxamide |
| SMILES | COc1cccc2c(Nc3ccc(CCCNCCN)cc3)c3cccc(C(=O)NCCN(C)C)c3nc12 |
| InChI | InChI=1S/C30H38N6O2/c1-36(2)20-19-33-30(37)25-10-4-8-23-27(24-9-5-11-26(38-3)29(24)35-28(23)25)34-22-14-12-21(13-15-22)7-6-17-32-18-16-31/h4-5,8-15,32H,6-7,16-20,31H2,1-3H3,(H,33,37)(H,34,35) |
| InChIKey | STAZOSLKAJMPHG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|