C34H32Cl2N4O4 — CID 25016254
[3-(acridin-9-ylamino)-5-(propanoylamino)phenyl]methyl [4-[bis(2-chloroethyl)amino]phenyl] carbonate (PubChem CID 25016254) has the molecular formula C34H32Cl2N4O4 and a molecular weight of 631.56 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-(propanoylamino)phenyl]methyl [4-[bis(2-chloroethyl)amino]phenyl] carbonate.
| Compound Name | [3-(acridin-9-ylamino)-5-(propanoylamino)phenyl]methyl [4-[bis(2-chloroethyl)amino]phenyl] carbonate |
|---|---|
| PubChem CID | 25016254 |
| Molecular Formula | C34H32Cl2N4O4 |
| Molecular Weight | 631.56 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-(propanoylamino)phenyl]methyl [4-[bis(2-chloroethyl)amino]phenyl] carbonate |
| SMILES | CCC(=O)Nc1cc(COC(=O)Oc2ccc(N(CCCl)CCCl)cc2)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C34H32Cl2N4O4/c1-2-32(41)37-24-19-23(22-43-34(42)44-27-13-11-26(12-14-27)40(17-15-35)18-16-36)20-25(21-24)38-33-28-7-3-5-9-30(28)39-31-10-6-4-8-29(31)33/h3-14,19-21H,2,15-18,22H2,1H3,(H,37,41)(H,38,39) |
| InChIKey | QUDAQRMBHVHZHC-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.56 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|