C34H30N4O5 — CID 91466885
[3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4,5-trimethoxyphenyl)carbamate (PubChem CID 91466885) has the molecular formula C34H30N4O5 and a molecular weight of 574.64 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4,5-trimethoxyphenyl)carbamate.
| Compound Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4,5-trimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 91466885 |
| Molecular Formula | C34H30N4O5 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4,5-trimethoxyphenyl)carbamate |
| SMILES | COc1cc(NC(=O)OCc2cc(Nc3c4ccccc4nc4ccccc34)cc(-c3ccc[nH]3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C34H30N4O5/c1-40-30-18-24(19-31(41-2)33(30)42-3)37-34(39)43-20-21-15-22(27-13-8-14-35-27)17-23(16-21)36-32-25-9-4-6-11-28(25)38-29-12-7-5-10-26(29)32/h4-19,35H,20H2,1-3H3,(H,36,38)(H,37,39) |
| InChIKey | MUZXIWOXZHUYDT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|