C29H24F2N4O2 — CID 22927137
[3-amino-5-[(3,4-dimethylacridin-9-yl)amino]phenyl]methyl N-(3,5-difluorophenyl)carbamate (PubChem CID 22927137) has the molecular formula C29H24F2N4O2 and a molecular weight of 498.53 g/mol. Its IUPAC name is [3-amino-5-[(3,4-dimethylacridin-9-yl)amino]phenyl]methyl N-(3,5-difluorophenyl)carbamate.
| Compound Name | [3-amino-5-[(3,4-dimethylacridin-9-yl)amino]phenyl]methyl N-(3,5-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 22927137 |
| Molecular Formula | C29H24F2N4O2 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [3-amino-5-[(3,4-dimethylacridin-9-yl)amino]phenyl]methyl N-(3,5-difluorophenyl)carbamate |
| SMILES | Cc1ccc2c(Nc3cc(N)cc(COC(=O)Nc4cc(F)cc(F)c4)c3)c3ccccc3nc2c1C |
| InChI | InChI=1S/C29H24F2N4O2/c1-16-7-8-25-27(17(16)2)35-26-6-4-3-5-24(26)28(25)33-22-10-18(9-21(32)14-22)15-37-29(36)34-23-12-19(30)11-20(31)13-23/h3-14H,15,32H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | KKKGYFHWCRCRNH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|