C20H15F4N3O4 — CID 162243406
benzyl N-(3,5-difluorophenyl)carbamate;N-(3,5-difluorophenyl)nitramide (PubChem CID 162243406) has the molecular formula C20H15F4N3O4 and a molecular weight of 437.35 g/mol. Its IUPAC name is benzyl N-(3,5-difluorophenyl)carbamate;N-(3,5-difluorophenyl)nitramide.
| Compound Name | benzyl N-(3,5-difluorophenyl)carbamate;N-(3,5-difluorophenyl)nitramide |
|---|---|
| PubChem CID | 162243406 |
| Molecular Formula | C20H15F4N3O4 |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | benzyl N-(3,5-difluorophenyl)carbamate;N-(3,5-difluorophenyl)nitramide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)OCc1ccccc1.O=[N+]([O-])Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H11F2NO2.C6H4F2N2O2/c15-11-6-12(16)8-13(7-11)17-14(18)19-9-10-4-2-1-3-5-10;7-4-1-5(8)3-6(2-4)9-10(11)12/h1-8H,9H2,(H,17,18);1-3,9H |
| InChIKey | ZWZUSGJXXKSPMO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|