C31H23ClN4O2 — CID 91126621
[3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(2-chlorophenyl)carbamate (PubChem CID 91126621) has the molecular formula C31H23ClN4O2 and a molecular weight of 519.00 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(2-chlorophenyl)carbamate.
| Compound Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(2-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 91126621 |
| Molecular Formula | C31H23ClN4O2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(2-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccccc1Cl)OCc1cc(Nc2c3ccccc3nc3ccccc23)cc(-c2ccc[nH]2)c1 |
| InChI | InChI=1S/C31H23ClN4O2/c32-25-10-3-6-13-29(25)36-31(37)38-19-20-16-21(26-14-7-15-33-26)18-22(17-20)34-30-23-8-1-4-11-27(23)35-28-12-5-2-9-24(28)30/h1-18,33H,19H2,(H,34,35)(H,36,37) |
| InChIKey | PZXVKQYEHVAZGV-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|