C33H26F2N4O2 — CID 91531274
[3-[(3,4-dimethylacridin-9-yl)amino]-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,5-difluorophenyl)carbamate (PubChem CID 91531274) has the molecular formula C33H26F2N4O2 and a molecular weight of 548.59 g/mol. Its IUPAC name is [3-[(3,4-dimethylacridin-9-yl)amino]-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,5-difluorophenyl)carbamate.
| Compound Name | [3-[(3,4-dimethylacridin-9-yl)amino]-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,5-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 91531274 |
| Molecular Formula | C33H26F2N4O2 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | [3-[(3,4-dimethylacridin-9-yl)amino]-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,5-difluorophenyl)carbamate |
| SMILES | Cc1ccc2c(Nc3cc(COC(=O)Nc4cc(F)cc(F)c4)cc(-c4ccc[nH]4)c3)c3ccccc3nc2c1C |
| InChI | InChI=1S/C33H26F2N4O2/c1-19-9-10-28-31(20(19)2)39-30-7-4-3-6-27(30)32(28)37-25-13-21(12-22(14-25)29-8-5-11-36-29)18-41-33(40)38-26-16-23(34)15-24(35)17-26/h3-17,36H,18H2,1-2H3,(H,37,39)(H,38,40) |
| InChIKey | UTZIBYRGKJAOKP-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|