C31H22Cl2N4O2 — CID 90706104
[3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,5-dichlorophenyl)carbamate (PubChem CID 90706104) has the molecular formula C31H22Cl2N4O2 and a molecular weight of 553.45 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,5-dichlorophenyl)carbamate.
| Compound Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,5-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 90706104 |
| Molecular Formula | C31H22Cl2N4O2 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,5-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)OCc1cc(Nc2c3ccccc3nc3ccccc23)cc(-c2ccc[nH]2)c1 |
| InChI | InChI=1S/C31H22Cl2N4O2/c32-21-15-22(33)17-24(16-21)36-31(38)39-18-19-12-20(27-10-5-11-34-27)14-23(13-19)35-30-25-6-1-3-8-28(25)37-29-9-4-2-7-26(29)30/h1-17,34H,18H2,(H,35,37)(H,36,38) |
| InChIKey | RMRNBYGTLKIXNI-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|