C31H22F2N4O2 — CID 91512216
[3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(2,5-difluorophenyl)carbamate (PubChem CID 91512216) has the molecular formula C31H22F2N4O2 and a molecular weight of 520.54 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(2,5-difluorophenyl)carbamate.
| Compound Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(2,5-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 91512216 |
| Molecular Formula | C31H22F2N4O2 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(2,5-difluorophenyl)carbamate |
| SMILES | O=C(Nc1cc(F)ccc1F)OCc1cc(Nc2c3ccccc3nc3ccccc23)cc(-c2ccc[nH]2)c1 |
| InChI | InChI=1S/C31H22F2N4O2/c32-21-11-12-25(33)29(17-21)37-31(38)39-18-19-14-20(26-10-5-13-34-26)16-22(15-19)35-30-23-6-1-3-8-27(23)36-28-9-4-2-7-24(28)30/h1-17,34H,18H2,(H,35,36)(H,37,38) |
| InChIKey | CAYYRLOGAYSZAI-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|