C26H25N3O3 — CID 57236716
[3-(acridin-9-ylamino)-5-aminophenyl]methyl 5-oxohexanoate (PubChem CID 57236716) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-aminophenyl]methyl 5-oxohexanoate.
| Compound Name | [3-(acridin-9-ylamino)-5-aminophenyl]methyl 5-oxohexanoate |
|---|---|
| PubChem CID | 57236716 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-aminophenyl]methyl 5-oxohexanoate |
| SMILES | CC(=O)CCCC(=O)OCc1cc(N)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C26H25N3O3/c1-17(30)7-6-12-25(31)32-16-18-13-19(27)15-20(14-18)28-26-21-8-2-4-10-23(21)29-24-11-5-3-9-22(24)26/h2-5,8-11,13-15H,6-7,12,16,27H2,1H3,(H,28,29) |
| InChIKey | MZRZEJOHPFREOV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|