C26H25N3O5 — CID 57083632
2-[3-(acridin-9-ylamino)-5-(2-carboxyethoxymethyl)anilino]propanoic acid (PubChem CID 57083632) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-[3-(acridin-9-ylamino)-5-(2-carboxyethoxymethyl)anilino]propanoic acid.
| Compound Name | 2-[3-(acridin-9-ylamino)-5-(2-carboxyethoxymethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 57083632 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[3-(acridin-9-ylamino)-5-(2-carboxyethoxymethyl)anilino]propanoic acid |
| SMILES | CC(Nc1cc(COCCC(=O)O)cc(Nc2c3ccccc3nc3ccccc23)c1)C(=O)O |
| InChI | InChI=1S/C26H25N3O5/c1-16(26(32)33)27-18-12-17(15-34-11-10-24(30)31)13-19(14-18)28-25-20-6-2-4-8-22(20)29-23-9-5-3-7-21(23)25/h2-9,12-14,16,27H,10-11,15H2,1H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | SYTLLKGNMHVEBN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|