C19H19N3O2 — CID 57058432
ethyl 2-[4-[(3-aminoquinolin-4-yl)amino]phenyl]acetate (PubChem CID 57058432) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is ethyl 2-[4-[(3-aminoquinolin-4-yl)amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(3-aminoquinolin-4-yl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 57058432 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | ethyl 2-[4-[(3-aminoquinolin-4-yl)amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Nc2c(N)cnc3ccccc23)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-2-24-18(23)11-13-7-9-14(10-8-13)22-19-15-5-3-4-6-17(15)21-12-16(19)20/h3-10,12H,2,11,20H2,1H3,(H,21,22) |
| InChIKey | PSUBAQKQYYANOV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |