C18H32Cl2N4O3 — CID 172793397
2-aminoethyl(trimethyl)azanium;(2S)-2,6-diaminohexanoate;2,4-dichlorobenzaldehyde (PubChem CID 172793397) has the molecular formula C18H32Cl2N4O3 and a molecular weight of 423.39 g/mol. Its IUPAC name is 2-aminoethyl(trimethyl)azanium;(2S)-2,6-diaminohexanoate;2,4-dichlorobenzaldehyde.
| Compound Name | 2-aminoethyl(trimethyl)azanium;(2S)-2,6-diaminohexanoate;2,4-dichlorobenzaldehyde |
|---|---|
| PubChem CID | 172793397 |
| Molecular Formula | C18H32Cl2N4O3 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-aminoethyl(trimethyl)azanium;(2S)-2,6-diaminohexanoate;2,4-dichlorobenzaldehyde |
| SMILES | C[N+](C)(C)CCN.NCCCC[C@H](N)C(=O)[O-].O=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H4Cl2O.C6H14N2O2.C5H15N2/c8-6-2-1-5(4-10)7(9)3-6;7-4-2-1-3-5(8)6(9)10;1-7(2,3)5-4-6/h1-4H;5H,1-4,7-8H2,(H,9,10);4-6H2,1-3H3/q;;+1/p-1/t;5-;/m.0./s1 |
| InChIKey | PWJOAEOXZMGGLY-NXAOXGSFSA-M |
| XLogP | 0.65 |
| TPSA | 135.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|