About (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride
(3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride (PubChem CID 162337925) has the molecular formula C13H28ClN3O4
and a molecular weight of 325.84 g/mol. Its IUPAC name is (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride.
Molecular Properties
| Compound Name | (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
| PubChem CID | 162337925 |
| Molecular Formula | C13H28ClN3O4 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)[C@@H](N)CCCCN.Cl |
| InChI | InChI=1S/C13H27N3O4.ClH/c1-16(2,3)9-10(8-12(17)18)20-13(19)11(15)6-4-5-7-14;/h10-11H,4-9,14-15H2,1-3H3;1H/t10-,11+;/m1./s1 |
| InChIKey | HQDOHVUQUWCURY-DHXVBOOMSA-N |
| XLogP | -1.38 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride?
The IUPAC name of (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride (CID 162337925) is (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride.
What is the SMILES notation for (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride?
The canonical SMILES for (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride is C[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)[C@@H](N)CCCCN.Cl.
What is the InChIKey of (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride?
The InChIKey is HQDOHVUQUWCURY-DHXVBOOMSA-N. The full InChI is InChI=1S/C13H27N3O4.ClH/c1-16(2,3)9-10(8-12(17)18)20-13(19)11(15)6-4-5-7-14;/h10-11H,4-9,14-15H2,1-3H3;1H/t10-,11+;/m1./s1.
What are the key properties of (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride?
(3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride has a molecular weight of 325.84 g/mol, XLogP of -1.38, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(2S)-2,6-diaminohexanoyl]oxy-4-(trimethylazaniumyl)butanoate;hydrochloride is sourced from PubChem (CID 162337925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).