C17H31N3O3 — CID 158229133
azane;(2S)-2,5-diaminopentanoic acid;4-pentylbenzaldehyde (PubChem CID 158229133) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is azane;(2S)-2,5-diaminopentanoic acid;4-pentylbenzaldehyde.
| Compound Name | azane;(2S)-2,5-diaminopentanoic acid;4-pentylbenzaldehyde |
|---|---|
| PubChem CID | 158229133 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | azane;(2S)-2,5-diaminopentanoic acid;4-pentylbenzaldehyde |
| SMILES | CCCCCc1ccc(C=O)cc1.N.NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H16O.C5H12N2O2.H3N/c1-2-3-4-5-11-6-8-12(10-13)9-7-11;6-3-1-2-4(7)5(8)9;/h6-10H,2-5H2,1H3;4H,1-3,6-7H2,(H,8,9);1H3/t;4-;/m.0./s1 |
| InChIKey | GEDWTPODPBPERK-INZIHYEWSA-N |
| XLogP | 2.53 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|