C20H22N2O6 — CID 22838755
(2S)-6-amino-2-[bis(4-hydroxybenzoyl)amino]hexanoic acid (PubChem CID 22838755) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2S)-6-amino-2-[bis(4-hydroxybenzoyl)amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[bis(4-hydroxybenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 22838755 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2S)-6-amino-2-[bis(4-hydroxybenzoyl)amino]hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N(C(=O)c1ccc(O)cc1)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H22N2O6/c21-12-2-1-3-17(20(27)28)22(18(25)13-4-8-15(23)9-5-13)19(26)14-6-10-16(24)11-7-14/h4-11,17,23-24H,1-3,12,21H2,(H,27,28)/t17-/m0/s1 |
| InChIKey | QAGWRJYSAPBQDM-KRWDZBQOSA-N |
| XLogP | 1.96 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|