C13H17FN2O5S — CID 91387836
6-amino-2-[(4-fluorosulfonylbenzoyl)amino]hexanoic acid (PubChem CID 91387836) has the molecular formula C13H17FN2O5S and a molecular weight of 332.35 g/mol. Its IUPAC name is 6-amino-2-[(4-fluorosulfonylbenzoyl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[(4-fluorosulfonylbenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 91387836 |
| Molecular Formula | C13H17FN2O5S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 6-amino-2-[(4-fluorosulfonylbenzoyl)amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)c1ccc(S(=O)(=O)F)cc1)C(=O)O |
| InChI | InChI=1S/C13H17FN2O5S/c14-22(20,21)10-6-4-9(5-7-10)12(17)16-11(13(18)19)3-1-2-8-15/h4-7,11H,1-3,8,15H2,(H,16,17)(H,18,19) |
| InChIKey | ZEPXOCTVZGELSG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|