C14H18N2O5 — CID 107835693
(2R)-2-[[4-(aminomethyl)benzoyl]amino]hexanedioic acid (PubChem CID 107835693) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2R)-2-[[4-(aminomethyl)benzoyl]amino]hexanedioic acid.
| Compound Name | (2R)-2-[[4-(aminomethyl)benzoyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 107835693 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2R)-2-[[4-(aminomethyl)benzoyl]amino]hexanedioic acid |
| SMILES | NCc1ccc(C(=O)N[C@H](CCCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O5/c15-8-9-4-6-10(7-5-9)13(19)16-11(14(20)21)2-1-3-12(17)18/h4-7,11H,1-3,8,15H2,(H,16,19)(H,17,18)(H,20,21)/t11-/m1/s1 |
| InChIKey | VDCYIRGLUYPMRM-LLVKDONJSA-N |
| XLogP | 0.58 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |