C15H16N4O5 — CID 135367151
2-[[4-(triazol-1-yl)benzoyl]amino]hexanedioic acid (PubChem CID 135367151) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[[4-(triazol-1-yl)benzoyl]amino]hexanedioic acid.
| Compound Name | 2-[[4-(triazol-1-yl)benzoyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 135367151 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[[4-(triazol-1-yl)benzoyl]amino]hexanedioic acid |
| SMILES | O=C(O)CCCC(NC(=O)c1ccc(-n2ccnn2)cc1)C(=O)O |
| InChI | InChI=1S/C15H16N4O5/c20-13(21)3-1-2-12(15(23)24)17-14(22)10-4-6-11(7-5-10)19-9-8-16-18-19/h4-9,12H,1-3H2,(H,17,22)(H,20,21)(H,23,24) |
| InChIKey | PCGMFAWPUFXRLU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |