C18H21N5O5S — CID 122488598
N-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1,5-dioxopentan-2-yl]-4-(triazol-1-yl)benzamide (PubChem CID 122488598) has the molecular formula C18H21N5O5S and a molecular weight of 419.46 g/mol. Its IUPAC name is N-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1,5-dioxopentan-2-yl]-4-(triazol-1-yl)benzamide.
| Compound Name | N-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1,5-dioxopentan-2-yl]-4-(triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 122488598 |
| Molecular Formula | C18H21N5O5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1,5-dioxopentan-2-yl]-4-(triazol-1-yl)benzamide |
| SMILES | O=CCC[C@H](NC(=O)c1ccc(-n2ccnn2)cc1)C(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H21N5O5S/c24-11-1-2-16(18(26)22-9-12-29(27,28)13-10-22)20-17(25)14-3-5-15(6-4-14)23-8-7-19-21-23/h3-8,11,16H,1-2,9-10,12-13H2,(H,20,25)/t16-/m0/s1 |
| InChIKey | DCPLASPWMRIRCK-INIZCTEOSA-N |
| XLogP | -0.40 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|