C21H22N2O7S2 — CID 122488696
4-(benzenesulfonyl)-N-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1,4-dioxobutan-2-yl]benzamide (PubChem CID 122488696) has the molecular formula C21H22N2O7S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1,4-dioxobutan-2-yl]benzamide.
| Compound Name | 4-(benzenesulfonyl)-N-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1,4-dioxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 122488696 |
| Molecular Formula | C21H22N2O7S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1,4-dioxobutan-2-yl]benzamide |
| SMILES | O=CC[C@H](NC(=O)c1ccc(S(=O)(=O)c2ccccc2)cc1)C(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C21H22N2O7S2/c24-13-10-19(21(26)23-11-14-31(27,28)15-12-23)22-20(25)16-6-8-18(9-7-16)32(29,30)17-4-2-1-3-5-17/h1-9,13,19H,10-12,14-15H2,(H,22,25)/t19-/m0/s1 |
| InChIKey | AOYDKMZKFSAJHY-IBGZPJMESA-N |
| XLogP | 0.46 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|