C37H42N2O5SSi — CID 175165367
N-[4-[tert-butyl(diphenyl)silyl]oxy-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxobutan-2-yl]-4-phenylbenzamide (PubChem CID 175165367) has the molecular formula C37H42N2O5SSi and a molecular weight of 654.91 g/mol. Its IUPAC name is N-[4-[tert-butyl(diphenyl)silyl]oxy-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxobutan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[4-[tert-butyl(diphenyl)silyl]oxy-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxobutan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 175165367 |
| Molecular Formula | C37H42N2O5SSi |
| Molecular Weight | 654.91 g/mol |
| Exact Mass | 654.26 |
| IUPAC Name | N-[4-[tert-butyl(diphenyl)silyl]oxy-1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxobutan-2-yl]-4-phenylbenzamide |
| SMILES | CC(C)(C)[Si](OCCC(NC(=O)c1ccc(-c2ccccc2)cc1)C(=O)N1CCS(=O)(=O)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H42N2O5SSi/c1-37(2,3)46(32-15-9-5-10-16-32,33-17-11-6-12-18-33)44-26-23-34(36(41)39-24-27-45(42,43)28-25-39)38-35(40)31-21-19-30(20-22-31)29-13-7-4-8-14-29/h4-22,34H,23-28H2,1-3H3,(H,38,40) |
| InChIKey | GQXNZCMNVBLERY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|