C33H38FN3O4S — CID 123495354
N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-6-[[2-(4-fluorophenyl)-1-methylcyclopropyl]amino]-1-oxohexan-2-yl]-4-phenylbenzamide (PubChem CID 123495354) has the molecular formula C33H38FN3O4S and a molecular weight of 591.75 g/mol. Its IUPAC name is N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-6-[[2-(4-fluorophenyl)-1-methylcyclopropyl]amino]-1-oxohexan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-6-[[2-(4-fluorophenyl)-1-methylcyclopropyl]amino]-1-oxohexan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 123495354 |
| Molecular Formula | C33H38FN3O4S |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-6-[[2-(4-fluorophenyl)-1-methylcyclopropyl]amino]-1-oxohexan-2-yl]-4-phenylbenzamide |
| SMILES | CC1(NCCCCC(NC(=O)c2ccc(-c3ccccc3)cc2)C(=O)N2CCS(=O)(=O)CC2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C33H38FN3O4S/c1-33(23-29(33)26-14-16-28(34)17-15-26)35-18-6-5-9-30(32(39)37-19-21-42(40,41)22-20-37)36-31(38)27-12-10-25(11-13-27)24-7-3-2-4-8-24/h2-4,7-8,10-17,29-30,35H,5-6,9,18-23H2,1H3,(H,36,38) |
| InChIKey | FWEIBXFPPFVMFU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|