C30H39FN2O3 — CID 158160804
4-fluoro-N-[(2S)-7-[(2R)-2-(4-methoxyphenyl)-1-methylcyclopropyl]-1-oxo-1-piperidin-1-ylheptan-2-yl]benzamide (PubChem CID 158160804) has the molecular formula C30H39FN2O3 and a molecular weight of 494.65 g/mol. Its IUPAC name is 4-fluoro-N-[(2S)-7-[(2R)-2-(4-methoxyphenyl)-1-methylcyclopropyl]-1-oxo-1-piperidin-1-ylheptan-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[(2S)-7-[(2R)-2-(4-methoxyphenyl)-1-methylcyclopropyl]-1-oxo-1-piperidin-1-ylheptan-2-yl]benzamide |
|---|---|
| PubChem CID | 158160804 |
| Molecular Formula | C30H39FN2O3 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 4-fluoro-N-[(2S)-7-[(2R)-2-(4-methoxyphenyl)-1-methylcyclopropyl]-1-oxo-1-piperidin-1-ylheptan-2-yl]benzamide |
| SMILES | COc1ccc([C@@H]2CC2(C)CCCCC[C@H](NC(=O)c2ccc(F)cc2)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H39FN2O3/c1-30(21-26(30)22-12-16-25(36-2)17-13-22)18-6-3-5-9-27(29(35)33-19-7-4-8-20-33)32-28(34)23-10-14-24(31)15-11-23/h10-17,26-27H,3-9,18-21H2,1-2H3,(H,32,34)/t26-,27-,30?/m0/s1 |
| InChIKey | BUTGIOXGNMTENO-WPVVHWIUSA-N |
| XLogP | 6.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|