C22H26N2O5S — CID 122488241
4-(benzenesulfonyl)-N-[(2S)-4-hydroxy-1-oxo-1-piperidin-1-ylbutan-2-yl]benzamide (PubChem CID 122488241) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[(2S)-4-hydroxy-1-oxo-1-piperidin-1-ylbutan-2-yl]benzamide.
| Compound Name | 4-(benzenesulfonyl)-N-[(2S)-4-hydroxy-1-oxo-1-piperidin-1-ylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 122488241 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[(2S)-4-hydroxy-1-oxo-1-piperidin-1-ylbutan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](CCO)C(=O)N1CCCCC1)c1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O5S/c25-16-13-20(22(27)24-14-5-2-6-15-24)23-21(26)17-9-11-19(12-10-17)30(28,29)18-7-3-1-4-8-18/h1,3-4,7-12,20,25H,2,5-6,13-16H2,(H,23,26)/t20-/m0/s1 |
| InChIKey | SJKBAGGFXWVIKC-FQEVSTJZSA-N |
| XLogP | 2.01 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |