C25H27Cl3N4O3S — CID 59849818
3,4-dichloro-N-[5-chloro-2-[4-[(2-piperidin-1-ylethylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide (PubChem CID 59849818) has the molecular formula C25H27Cl3N4O3S and a molecular weight of 569.94 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-chloro-2-[4-[(2-piperidin-1-ylethylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[5-chloro-2-[4-[(2-piperidin-1-ylethylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59849818 |
| Molecular Formula | C25H27Cl3N4O3S |
| Molecular Weight | 569.94 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 3,4-dichloro-N-[5-chloro-2-[4-[(2-piperidin-1-ylethylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cnc1Oc1ccc(CNCCN2CCCCC2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H27Cl3N4O3S/c26-19-14-24(31-36(33,34)21-8-9-22(27)23(28)15-21)25(30-17-19)35-20-6-4-18(5-7-20)16-29-10-13-32-11-2-1-3-12-32/h4-9,14-15,17,29,31H,1-3,10-13,16H2 |
| InChIKey | TZYMNEJYBDCOKX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.94 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|