C23H18Cl3F3N4O5S2 — CID 87747839
3,4-dichloro-N-[5-chloro-2-[4-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 87747839) has the molecular formula C23H18Cl3F3N4O5S2 and a molecular weight of 657.91 g/mol. Its IUPAC name is 3,4-dichloro-N-[5-chloro-2-[4-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3,4-dichloro-N-[5-chloro-2-[4-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87747839 |
| Molecular Formula | C23H18Cl3F3N4O5S2 |
| Molecular Weight | 657.91 g/mol |
| Exact Mass | 655.97 |
| IUPAC Name | 3,4-dichloro-N-[5-chloro-2-[4-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]phenoxy]-3-pyridinyl]benzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S(=O)(Nc1cc(Cl)cnc1Oc1ccc(CNC2=NCCS2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl3N4O3S2.C2HF3O2/c22-14-9-19(28-33(29,30)16-5-6-17(23)18(24)10-16)20(26-12-14)31-15-3-1-13(2-4-15)11-27-21-25-7-8-32-21;3-2(4,5)1(6)7/h1-6,9-10,12,28H,7-8,11H2,(H,25,27);(H,6,7) |
| InChIKey | XISRUERDEUSMPO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.91 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |