C23H24FN3O6S — CID 90705192
[[6-[4-[[2-(2-fluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid (PubChem CID 90705192) has the molecular formula C23H24FN3O6S and a molecular weight of 489.53 g/mol. Its IUPAC name is [[6-[4-[[2-(2-fluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid.
| Compound Name | [[6-[4-[[2-(2-fluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 90705192 |
| Molecular Formula | C23H24FN3O6S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [[6-[4-[[2-(2-fluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]pyridine-3-carbonyl]amino]methanesulfonic acid |
| SMILES | COc1cc(CNCCc2ccccc2F)ccc1Oc1ccc(C(=O)NCS(=O)(=O)O)cn1 |
| InChI | InChI=1S/C23H24FN3O6S/c1-32-21-12-16(13-25-11-10-17-4-2-3-5-19(17)24)6-8-20(21)33-22-9-7-18(14-26-22)23(28)27-15-34(29,30)31/h2-9,12,14,25H,10-11,13,15H2,1H3,(H,27,28)(H,29,30,31) |
| InChIKey | VRGKSTYRQMAYLB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|