C22H21BrN2O4 — CID 46488695
6-(4-bromophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 46488695) has the molecular formula C22H21BrN2O4 and a molecular weight of 457.32 g/mol. Its IUPAC name is 6-(4-bromophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-(4-bromophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46488695 |
| Molecular Formula | C22H21BrN2O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 6-(4-bromophenoxy)-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(Oc3ccc(Br)cc3)nc2)cc1OC |
| InChI | InChI=1S/C22H21BrN2O4/c1-27-19-9-3-15(13-20(19)28-2)11-12-24-22(26)16-4-10-21(25-14-16)29-18-7-5-17(23)6-8-18/h3-10,13-14H,11-12H2,1-2H3,(H,24,26) |
| InChIKey | OCLPJEIDAZDEML-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |