C23H23F2N3O2 — CID 89054451
1-[6-[4-[[2-(2,4-difluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-pyridinyl]ethenamine (PubChem CID 89054451) has the molecular formula C23H23F2N3O2 and a molecular weight of 411.45 g/mol. Its IUPAC name is 1-[6-[4-[[2-(2,4-difluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-pyridinyl]ethenamine.
| Compound Name | 1-[6-[4-[[2-(2,4-difluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-pyridinyl]ethenamine |
|---|---|
| PubChem CID | 89054451 |
| Molecular Formula | C23H23F2N3O2 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[6-[4-[[2-(2,4-difluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-pyridinyl]ethenamine |
| SMILES | C=C(N)c1ccc(Oc2ccc(CNCCc3ccc(F)cc3F)cc2OC)nc1 |
| InChI | InChI=1S/C23H23F2N3O2/c1-15(26)18-5-8-23(28-14-18)30-21-7-3-16(11-22(21)29-2)13-27-10-9-17-4-6-19(24)12-20(17)25/h3-8,11-12,14,27H,1,9-10,13,26H2,2H3 |
| InChIKey | HQTHXQSYUGHCSJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|