C25H26Cl2N2O3 — CID 66530394
2-[5-chloro-4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66530394) has the molecular formula C25H26Cl2N2O3 and a molecular weight of 473.40 g/mol. Its IUPAC name is 2-[5-chloro-4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-chloro-4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66530394 |
| Molecular Formula | C25H26Cl2N2O3 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-[5-chloro-4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(CNCCc2ccc(Cl)cc2)c(Cl)cc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H26Cl2N2O3/c1-17-3-9-21(10-4-17)29-25(30)16-32-24-14-22(27)19(13-23(24)31-2)15-28-12-11-18-5-7-20(26)8-6-18/h3-10,13-14,28H,11-12,15-16H2,1-2H3,(H,29,30) |
| InChIKey | TUTDNYYCZRICTI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|