C26H28Cl2N2O3 — CID 66531956
2-[5-chloro-4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66531956) has the molecular formula C26H28Cl2N2O3 and a molecular weight of 487.43 g/mol. Its IUPAC name is 2-[5-chloro-4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-chloro-4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66531956 |
| Molecular Formula | C26H28Cl2N2O3 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-[5-chloro-4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(CNCCc2ccc(Cl)cc2)c(Cl)cc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H28Cl2N2O3/c1-3-32-24-14-20(16-29-13-12-19-6-8-21(27)9-7-19)23(28)15-25(24)33-17-26(31)30-22-10-4-18(2)5-11-22/h4-11,14-15,29H,3,12-13,16-17H2,1-2H3,(H,30,31) |
| InChIKey | GEUJSJNEFKAHEM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|