C25H35ClN2O4 — CID 66531947
2-[4-[(3-butoxypropylamino)methyl]-5-chloro-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66531947) has the molecular formula C25H35ClN2O4 and a molecular weight of 463.02 g/mol. Its IUPAC name is 2-[4-[(3-butoxypropylamino)methyl]-5-chloro-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(3-butoxypropylamino)methyl]-5-chloro-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66531947 |
| Molecular Formula | C25H35ClN2O4 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[4-[(3-butoxypropylamino)methyl]-5-chloro-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCCCOCCCNCc1cc(OCC)c(OCC(=O)Nc2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C25H35ClN2O4/c1-4-6-13-30-14-7-12-27-17-20-15-23(31-5-2)24(16-22(20)26)32-18-25(29)28-21-10-8-19(3)9-11-21/h8-11,15-16,27H,4-7,12-14,17-18H2,1-3H3,(H,28,29) |
| InChIKey | DYUKQJSDFXMGNG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|