C22H21BrClNO3 — CID 66543394
N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-methoxyaniline (PubChem CID 66543394) has the molecular formula C22H21BrClNO3 and a molecular weight of 462.77 g/mol. Its IUPAC name is N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-methoxyaniline.
| Compound Name | N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 66543394 |
| Molecular Formula | C22H21BrClNO3 |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-[[6-bromo-2-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCc2c(Br)ccc(OC)c2OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H21BrClNO3/c1-26-18-9-7-17(8-10-18)25-13-19-20(23)11-12-21(27-2)22(19)28-14-15-3-5-16(24)6-4-15/h3-12,25H,13-14H2,1-2H3 |
| InChIKey | LXPILNJFJVGOKE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|