C14H11BrClNO2 — CID 66161040
N-[(2-bromo-5-chlorophenyl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 66161040) has the molecular formula C14H11BrClNO2 and a molecular weight of 340.60 g/mol. Its IUPAC name is N-[(2-bromo-5-chlorophenyl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(2-bromo-5-chlorophenyl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 66161040 |
| Molecular Formula | C14H11BrClNO2 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | N-[(2-bromo-5-chlorophenyl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Clc1ccc(Br)c(CNc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C14H11BrClNO2/c15-12-3-1-10(16)5-9(12)7-17-11-2-4-13-14(6-11)19-8-18-13/h1-6,17H,7-8H2 |
| InChIKey | WGAKYHSFRNJMKG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|